C12H24N4O3 — CID 71823809
tert-butyl 4-(1-hydrazinyl-1-oxopropan-2-yl)piperazine-1-carboxylate (PubChem CID 71823809) has the molecular formula C12H24N4O3 and a molecular weight of 272.35 g/mol. Its IUPAC name is tert-butyl 4-(1-hydrazinyl-1-oxopropan-2-yl)piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-(1-hydrazinyl-1-oxopropan-2-yl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 71823809 |
| Molecular Formula | C12H24N4O3 |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.18 |
| IUPAC Name | tert-butyl 4-(1-hydrazinyl-1-oxopropan-2-yl)piperazine-1-carboxylate |
| SMILES | CC(C(=O)NN)N1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C12H24N4O3/c1-9(10(17)14-13)15-5-7-16(8-6-15)11(18)19-12(2,3)4/h9H,5-8,13H2,1-4H3,(H,14,17) |
| InChIKey | SDHIHUUNGDRWRO-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 87.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|