C13H23BN4O5 — CID 131744195
[1-[1-[(2-methylpropan-2-yl)oxycarbonylamino]piperidin-4-yl]pyrazol-4-yl]oxyboronic acid (PubChem CID 131744195) has the molecular formula C13H23BN4O5 and a molecular weight of 326.16 g/mol. Its IUPAC name is [1-[1-[(2-methylpropan-2-yl)oxycarbonylamino]piperidin-4-yl]pyrazol-4-yl]oxyboronic acid.
| Compound Name | [1-[1-[(2-methylpropan-2-yl)oxycarbonylamino]piperidin-4-yl]pyrazol-4-yl]oxyboronic acid |
|---|---|
| PubChem CID | 131744195 |
| Molecular Formula | C13H23BN4O5 |
| Molecular Weight | 326.16 g/mol |
| Exact Mass | 326.18 |
| IUPAC Name | [1-[1-[(2-methylpropan-2-yl)oxycarbonylamino]piperidin-4-yl]pyrazol-4-yl]oxyboronic acid |
| SMILES | CC(C)(C)OC(=O)NN1CCC(n2cc(OB(O)O)cn2)CC1 |
| InChI | InChI=1S/C13H23BN4O5/c1-13(2,3)22-12(19)16-17-6-4-10(5-7-17)18-9-11(8-15-18)23-14(20)21/h8-10,20-21H,4-7H2,1-3H3,(H,16,19) |
| InChIKey | HWSOGMXVUCDLTR-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 109.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.16 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|