C16H30N4O2 — CID 144695482
tert-butyl N-[4-(4-aminopyrazol-1-yl)cyclohexyl]carbamate;ethane (PubChem CID 144695482) has the molecular formula C16H30N4O2 and a molecular weight of 310.44 g/mol. Its IUPAC name is tert-butyl N-[4-(4-aminopyrazol-1-yl)cyclohexyl]carbamate;ethane.
| Compound Name | tert-butyl N-[4-(4-aminopyrazol-1-yl)cyclohexyl]carbamate;ethane |
|---|---|
| PubChem CID | 144695482 |
| Molecular Formula | C16H30N4O2 |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.24 |
| IUPAC Name | tert-butyl N-[4-(4-aminopyrazol-1-yl)cyclohexyl]carbamate;ethane |
| SMILES | CC.CC(C)(C)OC(=O)NC1CCC(n2cc(N)cn2)CC1 |
| InChI | InChI=1S/C14H24N4O2.C2H6/c1-14(2,3)20-13(19)17-11-4-6-12(7-5-11)18-9-10(15)8-16-18;1-2/h8-9,11-12H,4-7,15H2,1-3H3,(H,17,19);1-2H3 |
| InChIKey | PELKSWXOXFQYQF-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 82.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |