C15H26F2N2O2 — CID 172628112
tert-butyl N-[4-(3,3-difluoropyrrolidin-1-yl)cyclohexyl]carbamate (PubChem CID 172628112) has the molecular formula C15H26F2N2O2 and a molecular weight of 304.38 g/mol. Its IUPAC name is tert-butyl N-[4-(3,3-difluoropyrrolidin-1-yl)cyclohexyl]carbamate.
| Compound Name | tert-butyl N-[4-(3,3-difluoropyrrolidin-1-yl)cyclohexyl]carbamate |
|---|---|
| PubChem CID | 172628112 |
| Molecular Formula | C15H26F2N2O2 |
| Molecular Weight | 304.38 g/mol |
| Exact Mass | 304.20 |
| IUPAC Name | tert-butyl N-[4-(3,3-difluoropyrrolidin-1-yl)cyclohexyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CCC(N2CCC(F)(F)C2)CC1 |
| InChI | InChI=1S/C15H26F2N2O2/c1-14(2,3)21-13(20)18-11-4-6-12(7-5-11)19-9-8-15(16,17)10-19/h11-12H,4-10H2,1-3H3,(H,18,20) |
| InChIKey | PBIKLZXBPNKNKO-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.38 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |