C18H32N2O3 — CID 178015378
tert-butyl N-[4-[4-(methoxymethylidene)piperidin-1-yl]cyclohexyl]carbamate (PubChem CID 178015378) has the molecular formula C18H32N2O3 and a molecular weight of 324.47 g/mol. Its IUPAC name is tert-butyl N-[4-[4-(methoxymethylidene)piperidin-1-yl]cyclohexyl]carbamate.
| Compound Name | tert-butyl N-[4-[4-(methoxymethylidene)piperidin-1-yl]cyclohexyl]carbamate |
|---|---|
| PubChem CID | 178015378 |
| Molecular Formula | C18H32N2O3 |
| Molecular Weight | 324.47 g/mol |
| Exact Mass | 324.24 |
| IUPAC Name | tert-butyl N-[4-[4-(methoxymethylidene)piperidin-1-yl]cyclohexyl]carbamate |
| SMILES | COC=C1CCN(C2CCC(NC(=O)OC(C)(C)C)CC2)CC1 |
| InChI | InChI=1S/C18H32N2O3/c1-18(2,3)23-17(21)19-15-5-7-16(8-6-15)20-11-9-14(10-12-20)13-22-4/h13,15-16H,5-12H2,1-4H3,(H,19,21) |
| InChIKey | DEYNDMQWGWRWSV-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.47 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|