C26H21N3O6 — CID 17273140
tert-butyl 2-(2'-amino-3'-cyano-2,5'-dioxospiro[indole-3,4'-pyrano[3,2-c]chromene]-1-yl)acetate (PubChem CID 17273140) has the molecular formula C26H21N3O6 and a molecular weight of 471.47 g/mol. Its IUPAC name is tert-butyl 2-(2'-amino-3'-cyano-2,5'-dioxospiro[indole-3,4'-pyrano[3,2-c]chromene]-1-yl)acetate.
| Compound Name | tert-butyl 2-(2'-amino-3'-cyano-2,5'-dioxospiro[indole-3,4'-pyrano[3,2-c]chromene]-1-yl)acetate |
|---|---|
| PubChem CID | 17273140 |
| Molecular Formula | C26H21N3O6 |
| Molecular Weight | 471.47 g/mol |
| Exact Mass | 471.14 |
| IUPAC Name | tert-butyl 2-(2'-amino-3'-cyano-2,5'-dioxospiro[indole-3,4'-pyrano[3,2-c]chromene]-1-yl)acetate |
| SMILES | CC(C)(C)OC(=O)CN1C(=O)C2(C(C#N)=C(N)Oc3c2c(=O)oc2ccccc32)c2ccccc21 |
| InChI | InChI=1S/C26H21N3O6/c1-25(2,3)35-19(30)13-29-17-10-6-5-9-15(17)26(24(29)32)16(12-27)22(28)34-21-14-8-4-7-11-18(14)33-23(31)20(21)26/h4-11H,13,28H2,1-3H3 |
| InChIKey | ZZHDTTTYKIKDRJ-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 135.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.47 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|