C23H17N3O4 — CID 41281756
(3S)-2'-amino-2,5'-dioxo-1-propylspiro[indole-3,4'-pyrano[3,2-c]chromene]-3'-carbonitrile (PubChem CID 41281756) has the molecular formula C23H17N3O4 and a molecular weight of 399.41 g/mol. Its IUPAC name is (3S)-2'-amino-2,5'-dioxo-1-propylspiro[indole-3,4'-pyrano[3,2-c]chromene]-3'-carbonitrile.
| Compound Name | (3S)-2'-amino-2,5'-dioxo-1-propylspiro[indole-3,4'-pyrano[3,2-c]chromene]-3'-carbonitrile |
|---|---|
| PubChem CID | 41281756 |
| Molecular Formula | C23H17N3O4 |
| Molecular Weight | 399.41 g/mol |
| Exact Mass | 399.12 |
| IUPAC Name | (3S)-2'-amino-2,5'-dioxo-1-propylspiro[indole-3,4'-pyrano[3,2-c]chromene]-3'-carbonitrile |
| SMILES | CCCN1C(=O)[C@]2(C(C#N)=C(N)Oc3c2c(=O)oc2ccccc32)c2ccccc21 |
| InChI | InChI=1S/C23H17N3O4/c1-2-11-26-16-9-5-4-8-14(16)23(22(26)28)15(12-24)20(25)30-19-13-7-3-6-10-17(13)29-21(27)18(19)23/h3-10H,2,11,25H2,1H3/t23-/m0/s1 |
| InChIKey | VSJNRLJIZHCADW-QHCPKHFHSA-N |
| XLogP | 2.92 |
| TPSA | 109.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.41 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|