C22H13N3O5 — CID 1216359
(3R)-1-acetyl-2'-amino-2,5'-dioxospiro[indole-3,4'-pyrano[3,2-c]chromene]-3'-carbonitrile (PubChem CID 1216359) has the molecular formula C22H13N3O5 and a molecular weight of 399.36 g/mol. Its IUPAC name is (3R)-1-acetyl-2'-amino-2,5'-dioxospiro[indole-3,4'-pyrano[3,2-c]chromene]-3'-carbonitrile.
| Compound Name | (3R)-1-acetyl-2'-amino-2,5'-dioxospiro[indole-3,4'-pyrano[3,2-c]chromene]-3'-carbonitrile |
|---|---|
| PubChem CID | 1216359 |
| Molecular Formula | C22H13N3O5 |
| Molecular Weight | 399.36 g/mol |
| Exact Mass | 399.09 |
| IUPAC Name | (3R)-1-acetyl-2'-amino-2,5'-dioxospiro[indole-3,4'-pyrano[3,2-c]chromene]-3'-carbonitrile |
| SMILES | CC(=O)N1C(=O)[C@@]2(C(C#N)=C(N)Oc3c2c(=O)oc2ccccc32)c2ccccc21 |
| InChI | InChI=1S/C22H13N3O5/c1-11(26)25-15-8-4-3-7-13(15)22(21(25)28)14(10-23)19(24)30-18-12-6-2-5-9-16(12)29-20(27)17(18)22/h2-9H,24H2,1H3/t22-/m1/s1 |
| InChIKey | HNTFXEBAPWCKKN-JOCHJYFZSA-N |
| XLogP | 2.06 |
| TPSA | 126.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.36 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|