C30H30N2O5 — CID 132560059
tert-butyl N-[1-benzyl-3-(3-ethyl-2-oxo-1-benzofuran-3-yl)-2-oxoindol-3-yl]carbamate (PubChem CID 132560059) has the molecular formula C30H30N2O5 and a molecular weight of 498.58 g/mol. Its IUPAC name is tert-butyl N-[1-benzyl-3-(3-ethyl-2-oxo-1-benzofuran-3-yl)-2-oxoindol-3-yl]carbamate.
| Compound Name | tert-butyl N-[1-benzyl-3-(3-ethyl-2-oxo-1-benzofuran-3-yl)-2-oxoindol-3-yl]carbamate |
|---|---|
| PubChem CID | 132560059 |
| Molecular Formula | C30H30N2O5 |
| Molecular Weight | 498.58 g/mol |
| Exact Mass | 498.22 |
| IUPAC Name | tert-butyl N-[1-benzyl-3-(3-ethyl-2-oxo-1-benzofuran-3-yl)-2-oxoindol-3-yl]carbamate |
| SMILES | CCC1(C2(NC(=O)OC(C)(C)C)C(=O)N(Cc3ccccc3)c3ccccc32)C(=O)Oc2ccccc21 |
| InChI | InChI=1S/C30H30N2O5/c1-5-29(22-16-10-12-18-24(22)36-26(29)34)30(31-27(35)37-28(2,3)4)21-15-9-11-17-23(21)32(25(30)33)19-20-13-7-6-8-14-20/h6-18H,5,19H2,1-4H3,(H,31,35) |
| InChIKey | YAVQUMBTCZUDIM-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.58 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|