C23H28N2O3S — CID 146166817
tert-butyl N-[3-(4-methylphenyl)sulfanyl-2-oxo-1-propylindol-3-yl]carbamate (PubChem CID 146166817) has the molecular formula C23H28N2O3S and a molecular weight of 412.56 g/mol. Its IUPAC name is tert-butyl N-[3-(4-methylphenyl)sulfanyl-2-oxo-1-propylindol-3-yl]carbamate.
| Compound Name | tert-butyl N-[3-(4-methylphenyl)sulfanyl-2-oxo-1-propylindol-3-yl]carbamate |
|---|---|
| PubChem CID | 146166817 |
| Molecular Formula | C23H28N2O3S |
| Molecular Weight | 412.56 g/mol |
| Exact Mass | 412.18 |
| IUPAC Name | tert-butyl N-[3-(4-methylphenyl)sulfanyl-2-oxo-1-propylindol-3-yl]carbamate |
| SMILES | CCCN1C(=O)C(NC(=O)OC(C)(C)C)(Sc2ccc(C)cc2)c2ccccc21 |
| InChI | InChI=1S/C23H28N2O3S/c1-6-15-25-19-10-8-7-9-18(19)23(20(25)26,24-21(27)28-22(3,4)5)29-17-13-11-16(2)12-14-17/h7-14H,6,15H2,1-5H3,(H,24,27) |
| InChIKey | VULSBORQTRLUHN-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.56 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|