C29H28N2O10 — CID 102337384
tetramethyl 1'-(4-ethoxyphenyl)-5-methyl-2-oxospiro[1H-indole-3,6'-pyridine]-2',3',4',5'-tetracarboxylate (PubChem CID 102337384) has the molecular formula C29H28N2O10 and a molecular weight of 564.55 g/mol. Its IUPAC name is tetramethyl 1'-(4-ethoxyphenyl)-5-methyl-2-oxospiro[1H-indole-3,6'-pyridine]-2',3',4',5'-tetracarboxylate.
| Compound Name | tetramethyl 1'-(4-ethoxyphenyl)-5-methyl-2-oxospiro[1H-indole-3,6'-pyridine]-2',3',4',5'-tetracarboxylate |
|---|---|
| PubChem CID | 102337384 |
| Molecular Formula | C29H28N2O10 |
| Molecular Weight | 564.55 g/mol |
| Exact Mass | 564.17 |
| IUPAC Name | tetramethyl 1'-(4-ethoxyphenyl)-5-methyl-2-oxospiro[1H-indole-3,6'-pyridine]-2',3',4',5'-tetracarboxylate |
| SMILES | CCOc1ccc(N2C(C(=O)OC)=C(C(=O)OC)C(C(=O)OC)=C(C(=O)OC)C23C(=O)Nc2ccc(C)cc23)cc1 |
| InChI | InChI=1S/C29H28N2O10/c1-7-41-17-11-9-16(10-12-17)31-23(27(35)40-6)21(25(33)38-4)20(24(32)37-3)22(26(34)39-5)29(31)18-14-15(2)8-13-19(18)30-28(29)36/h8-14H,7H2,1-6H3,(H,30,36) |
| InChIKey | BLTOXYKCQJRMFW-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 146.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.55 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|