C17H17F3N2O4 — CID 7320245
methyl (4R)-4-acetamido-1-benzyl-2-methyl-5-oxo-4-(trifluoromethyl)pyrrole-3-carboxylate (PubChem CID 7320245) has the molecular formula C17H17F3N2O4 and a molecular weight of 370.33 g/mol. Its IUPAC name is methyl (4R)-4-acetamido-1-benzyl-2-methyl-5-oxo-4-(trifluoromethyl)pyrrole-3-carboxylate.
| Compound Name | methyl (4R)-4-acetamido-1-benzyl-2-methyl-5-oxo-4-(trifluoromethyl)pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 7320245 |
| Molecular Formula | C17H17F3N2O4 |
| Molecular Weight | 370.33 g/mol |
| Exact Mass | 370.11 |
| IUPAC Name | methyl (4R)-4-acetamido-1-benzyl-2-methyl-5-oxo-4-(trifluoromethyl)pyrrole-3-carboxylate |
| SMILES | COC(=O)C1=C(C)N(Cc2ccccc2)C(=O)[C@@]1(NC(C)=O)C(F)(F)F |
| InChI | InChI=1S/C17H17F3N2O4/c1-10-13(14(24)26-3)16(17(18,19)20,21-11(2)23)15(25)22(10)9-12-7-5-4-6-8-12/h4-8H,9H2,1-3H3,(H,21,23)/t16-/m1/s1 |
| InChIKey | OGIKKKPSBJAVPE-MRXNPFEDSA-N |
| XLogP | 1.91 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.33 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |