C17H17F3N2O3 — CID 17382931
N-[4-acetyl-5-methyl-1-(4-methylphenyl)-2-oxo-3-(trifluoromethyl)pyrrol-3-yl]acetamide (PubChem CID 17382931) has the molecular formula C17H17F3N2O3 and a molecular weight of 354.33 g/mol. Its IUPAC name is N-[4-acetyl-5-methyl-1-(4-methylphenyl)-2-oxo-3-(trifluoromethyl)pyrrol-3-yl]acetamide.
| Compound Name | N-[4-acetyl-5-methyl-1-(4-methylphenyl)-2-oxo-3-(trifluoromethyl)pyrrol-3-yl]acetamide |
|---|---|
| PubChem CID | 17382931 |
| Molecular Formula | C17H17F3N2O3 |
| Molecular Weight | 354.33 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | N-[4-acetyl-5-methyl-1-(4-methylphenyl)-2-oxo-3-(trifluoromethyl)pyrrol-3-yl]acetamide |
| SMILES | CC(=O)NC1(C(F)(F)F)C(=O)N(c2ccc(C)cc2)C(C)=C1C(C)=O |
| InChI | InChI=1S/C17H17F3N2O3/c1-9-5-7-13(8-6-9)22-10(2)14(11(3)23)16(15(22)25,17(18,19)20)21-12(4)24/h5-8H,1-4H3,(H,21,24) |
| InChIKey | AUIGUSXZSGAYAU-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.33 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |