C21H20F3N3O4S — CID 25301042
N-[(3R)-4-acetyl-5-methyl-1-(2-methylphenyl)-2-oxo-3-(trifluoromethyl)pyrrol-3-yl]-4-aminobenzenesulfonamide (PubChem CID 25301042) has the molecular formula C21H20F3N3O4S and a molecular weight of 467.47 g/mol. Its IUPAC name is N-[(3R)-4-acetyl-5-methyl-1-(2-methylphenyl)-2-oxo-3-(trifluoromethyl)pyrrol-3-yl]-4-aminobenzenesulfonamide.
| Compound Name | N-[(3R)-4-acetyl-5-methyl-1-(2-methylphenyl)-2-oxo-3-(trifluoromethyl)pyrrol-3-yl]-4-aminobenzenesulfonamide |
|---|---|
| PubChem CID | 25301042 |
| Molecular Formula | C21H20F3N3O4S |
| Molecular Weight | 467.47 g/mol |
| Exact Mass | 467.11 |
| IUPAC Name | N-[(3R)-4-acetyl-5-methyl-1-(2-methylphenyl)-2-oxo-3-(trifluoromethyl)pyrrol-3-yl]-4-aminobenzenesulfonamide |
| SMILES | CC(=O)C1=C(C)N(c2ccccc2C)C(=O)[C@@]1(NS(=O)(=O)c1ccc(N)cc1)C(F)(F)F |
| InChI | InChI=1S/C21H20F3N3O4S/c1-12-6-4-5-7-17(12)27-13(2)18(14(3)28)20(19(27)29,21(22,23)24)26-32(30,31)16-10-8-15(25)9-11-16/h4-11,26H,25H2,1-3H3/t20-/m1/s1 |
| InChIKey | CROVWYYCGZSTMB-HXUWFJFHSA-N |
| XLogP | 3.07 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.47 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|