C51H46F2N4O10 — CID 102459968
CID 102459968 (PubChem CID 102459968) has the molecular formula C51H46F2N4O10 and a molecular weight of 912.94 g/mol.
| Compound Name | CID 102459968 |
|---|---|
| PubChem CID | 102459968 |
| Molecular Formula | C51H46F2N4O10 |
| Molecular Weight | 912.94 g/mol |
| Exact Mass | 912.32 |
| IUPAC Name | — |
| SMILES | CCOC(=O)C1C(C(=O)OC)=C(C(=O)OC)N2C(=C3C(N(C)C)=CC2C2(C(=O)N(Cc4ccccc4)c4ccc(F)cc42)C3C(=O)OCC)C12C(=O)N(Cc1ccccc1)c1ccc(F)cc12 |
| InChI | InChI=1S/C51H46F2N4O10/c1-7-66-45(59)40-38-36(54(3)4)25-37(50(40)32-23-30(52)19-21-34(32)55(48(50)62)26-28-15-11-9-12-16-28)57-42(47(61)65-6)39(44(58)64-5)41(46(60)67-8-2)51(43(38)57)33-24-31(53)20-22-35(33)56(49(51)63)27-29-17-13-10-14-18-29/h9-25,37,40-41H,7-8,26-27H2,1-6H3 |
| InChIKey | VETOEPHCTCKVSI-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 152.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 67 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 912.94 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|