C25H22FNO7 — CID 177491330
3-O-ethyl 1-O,2-O-dimethyl (Z,3E)-3-(1-benzyl-5-fluoro-2-oxoindol-3-ylidene)prop-1-ene-1,2,3-tricarboxylate (PubChem CID 177491330) has the molecular formula C25H22FNO7 and a molecular weight of 467.45 g/mol. Its IUPAC name is 3-O-ethyl 1-O,2-O-dimethyl (Z,3E)-3-(1-benzyl-5-fluoro-2-oxoindol-3-ylidene)prop-1-ene-1,2,3-tricarboxylate.
| Compound Name | 3-O-ethyl 1-O,2-O-dimethyl (Z,3E)-3-(1-benzyl-5-fluoro-2-oxoindol-3-ylidene)prop-1-ene-1,2,3-tricarboxylate |
|---|---|
| PubChem CID | 177491330 |
| Molecular Formula | C25H22FNO7 |
| Molecular Weight | 467.45 g/mol |
| Exact Mass | 467.14 |
| IUPAC Name | 3-O-ethyl 1-O,2-O-dimethyl (Z,3E)-3-(1-benzyl-5-fluoro-2-oxoindol-3-ylidene)prop-1-ene-1,2,3-tricarboxylate |
| SMILES | CCOC(=O)C(/C(=C/C(=O)OC)C(=O)OC)=C1/C(=O)N(Cc2ccccc2)c2ccc(F)cc21 |
| InChI | InChI=1S/C25H22FNO7/c1-4-34-25(31)22(18(24(30)33-3)13-20(28)32-2)21-17-12-16(26)10-11-19(17)27(23(21)29)14-15-8-6-5-7-9-15/h5-13H,4,14H2,1-3H3/b18-13-,22-21+ |
| InChIKey | BXNYCERETQGWBU-VJGKAAADSA-N |
| XLogP | 2.96 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.45 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|