C19H17F2NO3 — CID 139234923
ethyl 2-[(2R,3R)-1-benzyl-3-(2,6-difluorophenyl)aziridin-2-yl]-2-oxoacetate (PubChem CID 139234923) has the molecular formula C19H17F2NO3 and a molecular weight of 345.35 g/mol. Its IUPAC name is ethyl 2-[(2R,3R)-1-benzyl-3-(2,6-difluorophenyl)aziridin-2-yl]-2-oxoacetate.
| Compound Name | ethyl 2-[(2R,3R)-1-benzyl-3-(2,6-difluorophenyl)aziridin-2-yl]-2-oxoacetate |
|---|---|
| PubChem CID | 139234923 |
| Molecular Formula | C19H17F2NO3 |
| Molecular Weight | 345.35 g/mol |
| Exact Mass | 345.12 |
| IUPAC Name | ethyl 2-[(2R,3R)-1-benzyl-3-(2,6-difluorophenyl)aziridin-2-yl]-2-oxoacetate |
| SMILES | CCOC(=O)C(=O)[C@H]1[C@@H](c2c(F)cccc2F)N1Cc1ccccc1 |
| InChI | InChI=1S/C19H17F2NO3/c1-2-25-19(24)18(23)17-16(15-13(20)9-6-10-14(15)21)22(17)11-12-7-4-3-5-8-12/h3-10,16-17H,2,11H2,1H3/t16-,17-,22?/m1/s1 |
| InChIKey | OBQBIZWKNMQLCZ-SKLUMECTSA-N |
| XLogP | 3.02 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.35 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|