C25H21FN2O4 — CID 162479710
4-[[6-fluoro-2,4-dioxo-3-(2-phenylethyl)quinolin-1-yl]methyl]-N-hydroxybenzamide (PubChem CID 162479710) has the molecular formula C25H21FN2O4 and a molecular weight of 432.45 g/mol. Its IUPAC name is 4-[[6-fluoro-2,4-dioxo-3-(2-phenylethyl)quinolin-1-yl]methyl]-N-hydroxybenzamide.
| Compound Name | 4-[[6-fluoro-2,4-dioxo-3-(2-phenylethyl)quinolin-1-yl]methyl]-N-hydroxybenzamide |
|---|---|
| PubChem CID | 162479710 |
| Molecular Formula | C25H21FN2O4 |
| Molecular Weight | 432.45 g/mol |
| Exact Mass | 432.15 |
| IUPAC Name | 4-[[6-fluoro-2,4-dioxo-3-(2-phenylethyl)quinolin-1-yl]methyl]-N-hydroxybenzamide |
| SMILES | O=C(NO)c1ccc(CN2C(=O)C(CCc3ccccc3)C(=O)c3cc(F)ccc32)cc1 |
| InChI | InChI=1S/C25H21FN2O4/c26-19-11-13-22-21(14-19)23(29)20(12-8-16-4-2-1-3-5-16)25(31)28(22)15-17-6-9-18(10-7-17)24(30)27-32/h1-7,9-11,13-14,20,32H,8,12,15H2,(H,27,30) |
| InChIKey | TWICSCHUHCYFGL-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.45 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|