C16H13N3O4 — CID 155669332
4-[(5-amino-2,3-dioxoindol-1-yl)methyl]-N-hydroxybenzamide (PubChem CID 155669332) has the molecular formula C16H13N3O4 and a molecular weight of 311.30 g/mol. Its IUPAC name is 4-[(5-amino-2,3-dioxoindol-1-yl)methyl]-N-hydroxybenzamide.
| Compound Name | 4-[(5-amino-2,3-dioxoindol-1-yl)methyl]-N-hydroxybenzamide |
|---|---|
| PubChem CID | 155669332 |
| Molecular Formula | C16H13N3O4 |
| Molecular Weight | 311.30 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | 4-[(5-amino-2,3-dioxoindol-1-yl)methyl]-N-hydroxybenzamide |
| SMILES | Nc1ccc2c(c1)C(=O)C(=O)N2Cc1ccc(C(=O)NO)cc1 |
| InChI | InChI=1S/C16H13N3O4/c17-11-5-6-13-12(7-11)14(20)16(22)19(13)8-9-1-3-10(4-2-9)15(21)18-23/h1-7,23H,8,17H2,(H,18,21) |
| InChIKey | QVSSRSWGFCKXEG-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 112.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.30 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|