C11H13N3O2 — CID 125478045
5-amino-1-[(dimethylamino)methyl]indole-2,3-dione (PubChem CID 125478045) has the molecular formula C11H13N3O2 and a molecular weight of 219.24 g/mol. Its IUPAC name is 5-amino-1-[(dimethylamino)methyl]indole-2,3-dione.
| Compound Name | 5-amino-1-[(dimethylamino)methyl]indole-2,3-dione |
|---|---|
| PubChem CID | 125478045 |
| Molecular Formula | C11H13N3O2 |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.10 |
| IUPAC Name | 5-amino-1-[(dimethylamino)methyl]indole-2,3-dione |
| SMILES | CN(C)CN1C(=O)C(=O)c2cc(N)ccc21 |
| InChI | InChI=1S/C11H13N3O2/c1-13(2)6-14-9-4-3-7(12)5-8(9)10(15)11(14)16/h3-5H,6,12H2,1-2H3 |
| InChIKey | NMFHBLKXCXDFEK-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|