About ethyl 2-[3-(4,5-difluoro-2-hydroxyphenyl)-3-hydroxy-2-oxoindol-1-yl]acetate
ethyl 2-[3-(4,5-difluoro-2-hydroxyphenyl)-3-hydroxy-2-oxoindol-1-yl]acetate (PubChem CID 58872506) has the molecular formula C18H15F2NO5
and a molecular weight of 363.32 g/mol. Its IUPAC name is ethyl 2-[3-(4,5-difluoro-2-hydroxyphenyl)-3-hydroxy-2-oxoindol-1-yl]acetate.
Molecular Properties
| Compound Name | ethyl 2-[3-(4,5-difluoro-2-hydroxyphenyl)-3-hydroxy-2-oxoindol-1-yl]acetate |
| PubChem CID | 58872506 |
| Molecular Formula | C18H15F2NO5 |
| Molecular Weight | 363.32 g/mol |
| Exact Mass | 363.09 |
| IUPAC Name | ethyl 2-[3-(4,5-difluoro-2-hydroxyphenyl)-3-hydroxy-2-oxoindol-1-yl]acetate |
| SMILES | CCOC(=O)CN1C(=O)C(O)(c2cc(F)c(F)cc2O)c2ccccc21 |
| InChI | InChI=1S/C18H15F2NO5/c1-2-26-16(23)9-21-14-6-4-3-5-10(14)18(25,17(21)24)11-7-12(19)13(20)8-15(11)22/h3-8,22,25H,2,9H2,1H3 |
| InChIKey | OXHJXICFXIBKLQ-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.32 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl 2-[3-(4,5-difluoro-2-hydroxyphenyl)-3-hydroxy-2-oxoindol-1-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[3-(4,5-difluoro-2-hydroxyphenyl)-3-hydroxy-2-oxoindol-1-yl]acetate?
The IUPAC name of ethyl 2-[3-(4,5-difluoro-2-hydroxyphenyl)-3-hydroxy-2-oxoindol-1-yl]acetate (CID 58872506) is ethyl 2-[3-(4,5-difluoro-2-hydroxyphenyl)-3-hydroxy-2-oxoindol-1-yl]acetate.
What is the SMILES notation for ethyl 2-[3-(4,5-difluoro-2-hydroxyphenyl)-3-hydroxy-2-oxoindol-1-yl]acetate?
The canonical SMILES for ethyl 2-[3-(4,5-difluoro-2-hydroxyphenyl)-3-hydroxy-2-oxoindol-1-yl]acetate is CCOC(=O)CN1C(=O)C(O)(c2cc(F)c(F)cc2O)c2ccccc21.
What is the InChIKey of ethyl 2-[3-(4,5-difluoro-2-hydroxyphenyl)-3-hydroxy-2-oxoindol-1-yl]acetate?
The InChIKey is OXHJXICFXIBKLQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15F2NO5/c1-2-26-16(23)9-21-14-6-4-3-5-10(14)18(25,17(21)24)11-7-12(19)13(20)8-15(11)22/h3-8,22,25H,2,9H2,1H3.
What are the key properties of ethyl 2-[3-(4,5-difluoro-2-hydroxyphenyl)-3-hydroxy-2-oxoindol-1-yl]acetate?
ethyl 2-[3-(4,5-difluoro-2-hydroxyphenyl)-3-hydroxy-2-oxoindol-1-yl]acetate has a molecular weight of 363.32 g/mol, XLogP of 1.82, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[3-(4,5-difluoro-2-hydroxyphenyl)-3-hydroxy-2-oxoindol-1-yl]acetate is sourced from PubChem (CID 58872506), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).