C31H27FN2O3 — CID 59778184
benzyl N-[1-benzyl-6-(4-fluorophenyl)-3-methyl-2-oxo-4H-quinolin-3-yl]carbamate (PubChem CID 59778184) has the molecular formula C31H27FN2O3 and a molecular weight of 494.57 g/mol. Its IUPAC name is benzyl N-[1-benzyl-6-(4-fluorophenyl)-3-methyl-2-oxo-4H-quinolin-3-yl]carbamate.
| Compound Name | benzyl N-[1-benzyl-6-(4-fluorophenyl)-3-methyl-2-oxo-4H-quinolin-3-yl]carbamate |
|---|---|
| PubChem CID | 59778184 |
| Molecular Formula | C31H27FN2O3 |
| Molecular Weight | 494.57 g/mol |
| Exact Mass | 494.20 |
| IUPAC Name | benzyl N-[1-benzyl-6-(4-fluorophenyl)-3-methyl-2-oxo-4H-quinolin-3-yl]carbamate |
| SMILES | CC1(NC(=O)OCc2ccccc2)Cc2cc(-c3ccc(F)cc3)ccc2N(Cc2ccccc2)C1=O |
| InChI | InChI=1S/C31H27FN2O3/c1-31(33-30(36)37-21-23-10-6-3-7-11-23)19-26-18-25(24-12-15-27(32)16-13-24)14-17-28(26)34(29(31)35)20-22-8-4-2-5-9-22/h2-18H,19-21H2,1H3,(H,33,36) |
| InChIKey | HFTIBXYAIJMMTO-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.57 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |