C26H27N2O6P — CID 102500658
tert-butyl N-[(3R)-3-diphenoxyphosphoryl-1-methyl-2-oxoindol-3-yl]carbamate (PubChem CID 102500658) has the molecular formula C26H27N2O6P and a molecular weight of 494.48 g/mol. Its IUPAC name is tert-butyl N-[(3R)-3-diphenoxyphosphoryl-1-methyl-2-oxoindol-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3R)-3-diphenoxyphosphoryl-1-methyl-2-oxoindol-3-yl]carbamate |
|---|---|
| PubChem CID | 102500658 |
| Molecular Formula | C26H27N2O6P |
| Molecular Weight | 494.48 g/mol |
| Exact Mass | 494.16 |
| IUPAC Name | tert-butyl N-[(3R)-3-diphenoxyphosphoryl-1-methyl-2-oxoindol-3-yl]carbamate |
| SMILES | CN1C(=O)[C@](NC(=O)OC(C)(C)C)(P(=O)(Oc2ccccc2)Oc2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C26H27N2O6P/c1-25(2,3)32-24(30)27-26(21-17-11-12-18-22(21)28(4)23(26)29)35(31,33-19-13-7-5-8-14-19)34-20-15-9-6-10-16-20/h5-18H,1-4H3,(H,27,30)/t26-/m1/s1 |
| InChIKey | VSVSSMYIFJTVGT-AREMUKBSSA-N |
| XLogP | 5.69 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.48 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|