C16H21N3O5 — CID 102127850
tert-butyl N-[(3R)-1,5-dimethyl-3-(nitromethyl)-2-oxoindol-3-yl]carbamate (PubChem CID 102127850) has the molecular formula C16H21N3O5 and a molecular weight of 335.36 g/mol. Its IUPAC name is tert-butyl N-[(3R)-1,5-dimethyl-3-(nitromethyl)-2-oxoindol-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3R)-1,5-dimethyl-3-(nitromethyl)-2-oxoindol-3-yl]carbamate |
|---|---|
| PubChem CID | 102127850 |
| Molecular Formula | C16H21N3O5 |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 335.15 |
| IUPAC Name | tert-butyl N-[(3R)-1,5-dimethyl-3-(nitromethyl)-2-oxoindol-3-yl]carbamate |
| SMILES | Cc1ccc2c(c1)[C@](C[N+](=O)[O-])(NC(=O)OC(C)(C)C)C(=O)N2C |
| InChI | InChI=1S/C16H21N3O5/c1-10-6-7-12-11(8-10)16(9-19(22)23,13(20)18(12)5)17-14(21)24-15(2,3)4/h6-8H,9H2,1-5H3,(H,17,21)/t16-/m0/s1 |
| InChIKey | NJRYXDAMNZOPSZ-INIZCTEOSA-N |
| XLogP | 1.97 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.36 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|