C36H30N4O4 — CID 166441608
tert-butyl (3S,3'R,4'S,5'R)-3'-(2,2-dicyanoethenyl)-1'-hydroxy-4'-naphthalen-1-yl-2-oxo-5'-phenylspiro[indole-3,2'-pyrrolidine]-1-carboxylate (PubChem CID 166441608) has the molecular formula C36H30N4O4 and a molecular weight of 582.66 g/mol. Its IUPAC name is tert-butyl (3S,3'R,4'S,5'R)-3'-(2,2-dicyanoethenyl)-1'-hydroxy-4'-naphthalen-1-yl-2-oxo-5'-phenylspiro[indole-3,2'-pyrrolidine]-1-carboxylate.
| Compound Name | tert-butyl (3S,3'R,4'S,5'R)-3'-(2,2-dicyanoethenyl)-1'-hydroxy-4'-naphthalen-1-yl-2-oxo-5'-phenylspiro[indole-3,2'-pyrrolidine]-1-carboxylate |
|---|---|
| PubChem CID | 166441608 |
| Molecular Formula | C36H30N4O4 |
| Molecular Weight | 582.66 g/mol |
| Exact Mass | 582.23 |
| IUPAC Name | tert-butyl (3S,3'R,4'S,5'R)-3'-(2,2-dicyanoethenyl)-1'-hydroxy-4'-naphthalen-1-yl-2-oxo-5'-phenylspiro[indole-3,2'-pyrrolidine]-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C(=O)[C@@]2(c3ccccc31)[C@H](C=C(C#N)C#N)[C@@H](c1cccc3ccccc13)[C@H](c1ccccc1)N2O |
| InChI | InChI=1S/C36H30N4O4/c1-35(2,3)44-34(42)39-30-19-10-9-18-28(30)36(33(39)41)29(20-23(21-37)22-38)31(32(40(36)43)25-13-5-4-6-14-25)27-17-11-15-24-12-7-8-16-26(24)27/h4-20,29,31-32,43H,1-3H3/t29-,31-,32+,36-/m1/s1 |
| InChIKey | ROFXDRPQIVDHCT-OBSOYVQYSA-N |
| XLogP | 7.14 |
| TPSA | 117.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.66 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|