C28H25N3O5 — CID 177498806
tert-butyl (3S)-3-(3,3-dicyano-2-phenylprop-2-enyl)-3-(3-methoxy-3-oxoprop-1-en-2-yl)-2-oxoindole-1-carboxylate (PubChem CID 177498806) has the molecular formula C28H25N3O5 and a molecular weight of 483.52 g/mol. Its IUPAC name is tert-butyl (3S)-3-(3,3-dicyano-2-phenylprop-2-enyl)-3-(3-methoxy-3-oxoprop-1-en-2-yl)-2-oxoindole-1-carboxylate.
| Compound Name | tert-butyl (3S)-3-(3,3-dicyano-2-phenylprop-2-enyl)-3-(3-methoxy-3-oxoprop-1-en-2-yl)-2-oxoindole-1-carboxylate |
|---|---|
| PubChem CID | 177498806 |
| Molecular Formula | C28H25N3O5 |
| Molecular Weight | 483.52 g/mol |
| Exact Mass | 483.18 |
| IUPAC Name | tert-butyl (3S)-3-(3,3-dicyano-2-phenylprop-2-enyl)-3-(3-methoxy-3-oxoprop-1-en-2-yl)-2-oxoindole-1-carboxylate |
| SMILES | C=C(C(=O)OC)[C@@]1(CC(=C(C#N)C#N)c2ccccc2)C(=O)N(C(=O)OC(C)(C)C)c2ccccc21 |
| InChI | InChI=1S/C28H25N3O5/c1-18(24(32)35-5)28(15-21(20(16-29)17-30)19-11-7-6-8-12-19)22-13-9-10-14-23(22)31(25(28)33)26(34)36-27(2,3)4/h6-14H,1,15H2,2-5H3/t28-/m1/s1 |
| InChIKey | QTKWLSZBICGMGQ-MUUNZHRXSA-N |
| XLogP | 4.83 |
| TPSA | 120.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.52 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|