C32H26N4O4 — CID 166441610
tert-butyl (2S,3R,4S)-3-(2,2-dicyanoethenyl)-1-oxido-2'-oxo-4,5-diphenylspiro[3,4-dihydropyrrol-1-ium-2,3'-indole]-1'-carboxylate (PubChem CID 166441610) has the molecular formula C32H26N4O4 and a molecular weight of 530.58 g/mol. Its IUPAC name is tert-butyl (2S,3R,4S)-3-(2,2-dicyanoethenyl)-1-oxido-2'-oxo-4,5-diphenylspiro[3,4-dihydropyrrol-1-ium-2,3'-indole]-1'-carboxylate.
| Compound Name | tert-butyl (2S,3R,4S)-3-(2,2-dicyanoethenyl)-1-oxido-2'-oxo-4,5-diphenylspiro[3,4-dihydropyrrol-1-ium-2,3'-indole]-1'-carboxylate |
|---|---|
| PubChem CID | 166441610 |
| Molecular Formula | C32H26N4O4 |
| Molecular Weight | 530.58 g/mol |
| Exact Mass | 530.20 |
| IUPAC Name | tert-butyl (2S,3R,4S)-3-(2,2-dicyanoethenyl)-1-oxido-2'-oxo-4,5-diphenylspiro[3,4-dihydropyrrol-1-ium-2,3'-indole]-1'-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C(=O)[C@@]2(c3ccccc31)[C@H](C=C(C#N)C#N)[C@@H](c1ccccc1)C(c1ccccc1)=[N+]2[O-] |
| InChI | InChI=1S/C32H26N4O4/c1-31(2,3)40-30(38)35-26-17-11-10-16-24(26)32(29(35)37)25(18-21(19-33)20-34)27(22-12-6-4-7-13-22)28(36(32)39)23-14-8-5-9-15-23/h4-18,25,27H,1-3H3/t25-,27-,32-/m1/s1 |
| InChIKey | GAULGKBTFVQMEE-ZLIYTTPCSA-N |
| XLogP | 5.55 |
| TPSA | 120.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.58 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|