tert-butyl 3,3-dimethyl-2-methylidenepyrrolidine-1-carboxylate

C12H21NO2 — CID 123959315

IUPACtert-butyl 3,3-dimethyl-2-methylidenepyrrolidine-1-carboxylate
SMILESC=C1N(C(=O)OC(C)(C)C)CCC1(C)C
InChIInChI=1S/C12H21NO2/c1-9-12(5,6)7-8-13(9)10(14)15-11(2,3)4/h1,7-8H2,2-6H3
InChIKeyRPDOHEDAXUBNAY-UHFFFAOYSA-N
MW211.30 g/mol
LogP3.17
Rot. Bonds

About tert-butyl 3,3-dimethyl-2-methylidenepyrrolidine-1-carboxylate

tert-butyl 3,3-dimethyl-2-methylidenepyrrolidine-1-carboxylate (PubChem CID 123959315) has the molecular formula C12H21NO2 and a molecular weight of 211.30 g/mol. Its IUPAC name is tert-butyl 3,3-dimethyl-2-methylidenepyrrolidine-1-carboxylate.

Molecular Properties

Compound Nametert-butyl 3,3-dimethyl-2-methylidenepyrrolidine-1-carboxylate
PubChem CID123959315
Molecular FormulaC12H21NO2
Molecular Weight211.30 g/mol
Exact Mass211.16
IUPAC Nametert-butyl 3,3-dimethyl-2-methylidenepyrrolidine-1-carboxylate
SMILESC=C1N(C(=O)OC(C)(C)C)CCC1(C)C
InChIInChI=1S/C12H21NO2/c1-9-12(5,6)7-8-13(9)10(14)15-11(2,3)4/h1,7-8H2,2-6H3
InChIKeyRPDOHEDAXUBNAY-UHFFFAOYSA-N
XLogP3.17
TPSA29.54 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500211.30
LogP ≤ 53.17
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Analyze tert-butyl 3,3-dimethyl-2-methylidenepyrrolidine-1-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of tert-butyl 3,3-dimethyl-2-methylidenepyrrolidine-1-carboxylate?
The IUPAC name of tert-butyl 3,3-dimethyl-2-methylidenepyrrolidine-1-carboxylate (CID 123959315) is tert-butyl 3,3-dimethyl-2-methylidenepyrrolidine-1-carboxylate.
What is the SMILES notation for tert-butyl 3,3-dimethyl-2-methylidenepyrrolidine-1-carboxylate?
The canonical SMILES for tert-butyl 3,3-dimethyl-2-methylidenepyrrolidine-1-carboxylate is C=C1N(C(=O)OC(C)(C)C)CCC1(C)C.
What is the InChIKey of tert-butyl 3,3-dimethyl-2-methylidenepyrrolidine-1-carboxylate?
The InChIKey is RPDOHEDAXUBNAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21NO2/c1-9-12(5,6)7-8-13(9)10(14)15-11(2,3)4/h1,7-8H2,2-6H3.
What are the key properties of tert-butyl 3,3-dimethyl-2-methylidenepyrrolidine-1-carboxylate?
tert-butyl 3,3-dimethyl-2-methylidenepyrrolidine-1-carboxylate has a molecular weight of 211.30 g/mol, XLogP of 3.17, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 3,3-dimethyl-2-methylidenepyrrolidine-1-carboxylate is sourced from PubChem (CID 123959315), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).