C11H14BrNO2 — CID 15634796
4-amino-6-bromo-2,2-dimethyl-3,4-dihydrochromen-3-ol (PubChem CID 15634796) has the molecular formula C11H14BrNO2 and a molecular weight of 272.14 g/mol. Its IUPAC name is 4-amino-6-bromo-2,2-dimethyl-3,4-dihydrochromen-3-ol.
| Compound Name | 4-amino-6-bromo-2,2-dimethyl-3,4-dihydrochromen-3-ol |
|---|---|
| PubChem CID | 15634796 |
| Molecular Formula | C11H14BrNO2 |
| Molecular Weight | 272.14 g/mol |
| Exact Mass | 271.02 |
| IUPAC Name | 4-amino-6-bromo-2,2-dimethyl-3,4-dihydrochromen-3-ol |
| SMILES | CC1(C)Oc2ccc(Br)cc2C(N)C1O |
| InChI | InChI=1S/C11H14BrNO2/c1-11(2)10(14)9(13)7-5-6(12)3-4-8(7)15-11/h3-5,9-10,14H,13H2,1-2H3 |
| InChIKey | NGWYVWUSWGJIDL-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.14 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |