C22H25ClN6O6 — CID 69214840
(2R,3R,4R)-4-[4-chloro-N-[(2-methyltetrazol-5-yl)methyl]anilino]-2-(dimethoxymethyl)-2-methyl-6-nitro-3,4-dihydrochromen-3-ol (PubChem CID 69214840) has the molecular formula C22H25ClN6O6 and a molecular weight of 504.93 g/mol. Its IUPAC name is (2R,3R,4R)-4-[4-chloro-N-[(2-methyltetrazol-5-yl)methyl]anilino]-2-(dimethoxymethyl)-2-methyl-6-nitro-3,4-dihydrochromen-3-ol.
| Compound Name | (2R,3R,4R)-4-[4-chloro-N-[(2-methyltetrazol-5-yl)methyl]anilino]-2-(dimethoxymethyl)-2-methyl-6-nitro-3,4-dihydrochromen-3-ol |
|---|---|
| PubChem CID | 69214840 |
| Molecular Formula | C22H25ClN6O6 |
| Molecular Weight | 504.93 g/mol |
| Exact Mass | 504.15 |
| IUPAC Name | (2R,3R,4R)-4-[4-chloro-N-[(2-methyltetrazol-5-yl)methyl]anilino]-2-(dimethoxymethyl)-2-methyl-6-nitro-3,4-dihydrochromen-3-ol |
| SMILES | COC(OC)[C@]1(C)Oc2ccc([N+](=O)[O-])cc2[C@@H](N(Cc2nnn(C)n2)c2ccc(Cl)cc2)[C@H]1O |
| InChI | InChI=1S/C22H25ClN6O6/c1-22(21(33-3)34-4)20(30)19(16-11-15(29(31)32)9-10-17(16)35-22)28(12-18-24-26-27(2)25-18)14-7-5-13(23)6-8-14/h5-11,19-21,30H,12H2,1-4H3/t19-,20-,22-/m1/s1 |
| InChIKey | PRFYPXDIJYYTDP-KCZVDYSFSA-N |
| XLogP | 2.65 |
| TPSA | 137.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.93 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|