C25H31ClN6O7 — CID 69213587
(2S,3S,4R)-4-[4-chloro-N-[[2-(1-ethoxyethyl)tetrazol-5-yl]methyl]anilino]-2-(dimethoxymethyl)-2-methyl-6-nitro-3,4-dihydrochromen-3-ol (PubChem CID 69213587) has the molecular formula C25H31ClN6O7 and a molecular weight of 563.01 g/mol. Its IUPAC name is (2S,3S,4R)-4-[4-chloro-N-[[2-(1-ethoxyethyl)tetrazol-5-yl]methyl]anilino]-2-(dimethoxymethyl)-2-methyl-6-nitro-3,4-dihydrochromen-3-ol.
| Compound Name | (2S,3S,4R)-4-[4-chloro-N-[[2-(1-ethoxyethyl)tetrazol-5-yl]methyl]anilino]-2-(dimethoxymethyl)-2-methyl-6-nitro-3,4-dihydrochromen-3-ol |
|---|---|
| PubChem CID | 69213587 |
| Molecular Formula | C25H31ClN6O7 |
| Molecular Weight | 563.01 g/mol |
| Exact Mass | 562.19 |
| IUPAC Name | (2S,3S,4R)-4-[4-chloro-N-[[2-(1-ethoxyethyl)tetrazol-5-yl]methyl]anilino]-2-(dimethoxymethyl)-2-methyl-6-nitro-3,4-dihydrochromen-3-ol |
| SMILES | CCOC(C)n1nnc(CN(c2ccc(Cl)cc2)[C@@H]2c3cc([N+](=O)[O-])ccc3O[C@](C)(C(OC)OC)[C@H]2O)n1 |
| InChI | InChI=1S/C25H31ClN6O7/c1-6-38-15(2)31-28-21(27-29-31)14-30(17-9-7-16(26)8-10-17)22-19-13-18(32(34)35)11-12-20(19)39-25(3,23(22)33)24(36-4)37-5/h7-13,15,22-24,33H,6,14H2,1-5H3/t15?,22-,23+,25+/m1/s1 |
| InChIKey | DCTIKSFQBJQVEW-YHSRKIGJSA-N |
| XLogP | 3.67 |
| TPSA | 147.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.01 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|