C21H24N6O6 — CID 10310593
(2S,3S,4R)-2-(dimethoxymethyl)-2-methyl-6-nitro-4-[N-(2H-tetrazol-5-ylmethyl)anilino]-3,4-dihydrochromen-3-ol (PubChem CID 10310593) has the molecular formula C21H24N6O6 and a molecular weight of 456.46 g/mol. Its IUPAC name is (2S,3S,4R)-2-(dimethoxymethyl)-2-methyl-6-nitro-4-[N-(2H-tetrazol-5-ylmethyl)anilino]-3,4-dihydrochromen-3-ol.
| Compound Name | (2S,3S,4R)-2-(dimethoxymethyl)-2-methyl-6-nitro-4-[N-(2H-tetrazol-5-ylmethyl)anilino]-3,4-dihydrochromen-3-ol |
|---|---|
| PubChem CID | 10310593 |
| Molecular Formula | C21H24N6O6 |
| Molecular Weight | 456.46 g/mol |
| Exact Mass | 456.18 |
| IUPAC Name | (2S,3S,4R)-2-(dimethoxymethyl)-2-methyl-6-nitro-4-[N-(2H-tetrazol-5-ylmethyl)anilino]-3,4-dihydrochromen-3-ol |
| SMILES | COC(OC)[C@@]1(C)Oc2ccc([N+](=O)[O-])cc2[C@@H](N(Cc2nn[nH]n2)c2ccccc2)[C@@H]1O |
| InChI | InChI=1S/C21H24N6O6/c1-21(20(31-2)32-3)19(28)18(15-11-14(27(29)30)9-10-16(15)33-21)26(12-17-22-24-25-23-17)13-7-5-4-6-8-13/h4-11,18-20,28H,12H2,1-3H3,(H,22,23,24,25)/t18-,19+,21+/m1/s1 |
| InChIKey | LMTHXUXOTADTPJ-DYXWJJEUSA-N |
| XLogP | 1.99 |
| TPSA | 148.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.46 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|