2,2,4,4-tetrafluoro-1,3-benzodioxine-6-carboxylic acid

C9H4F4O4 — CID 154306048

IUPAC2,2,4,4-tetrafluoro-1,3-benzodioxine-6-carboxylic acid
SMILESO=C(O)c1ccc2c(c1)C(F)(F)OC(F)(F)O2
InChIInChI=1S/C9H4F4O4/c10-8(11)5-3-4(7(14)15)1-2-6(5)16-9(12,13)17-8/h1-3H,(H,14,15)
InChIKeyCPZNLLATGPLFOD-UHFFFAOYSA-N
MW252.12 g/mol
LogP2.39
Rot. Bonds1

About 2,2,4,4-tetrafluoro-1,3-benzodioxine-6-carboxylic acid

2,2,4,4-tetrafluoro-1,3-benzodioxine-6-carboxylic acid (PubChem CID 154306048) has the molecular formula C9H4F4O4 and a molecular weight of 252.12 g/mol. Its IUPAC name is 2,2,4,4-tetrafluoro-1,3-benzodioxine-6-carboxylic acid.

Molecular Properties

Compound Name2,2,4,4-tetrafluoro-1,3-benzodioxine-6-carboxylic acid
PubChem CID154306048
Molecular FormulaC9H4F4O4
Molecular Weight252.12 g/mol
Exact Mass252.00
IUPAC Name2,2,4,4-tetrafluoro-1,3-benzodioxine-6-carboxylic acid
SMILESO=C(O)c1ccc2c(c1)C(F)(F)OC(F)(F)O2
InChIInChI=1S/C9H4F4O4/c10-8(11)5-3-4(7(14)15)1-2-6(5)16-9(12,13)17-8/h1-3H,(H,14,15)
InChIKeyCPZNLLATGPLFOD-UHFFFAOYSA-N
XLogP2.39
TPSA55.76 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500252.12
LogP ≤ 52.39
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2,2,4,4-tetrafluoro-1,3-benzodioxine-6-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,2,4,4-tetrafluoro-1,3-benzodioxine-6-carboxylic acid?
The IUPAC name of 2,2,4,4-tetrafluoro-1,3-benzodioxine-6-carboxylic acid (CID 154306048) is 2,2,4,4-tetrafluoro-1,3-benzodioxine-6-carboxylic acid.
What is the SMILES notation for 2,2,4,4-tetrafluoro-1,3-benzodioxine-6-carboxylic acid?
The canonical SMILES for 2,2,4,4-tetrafluoro-1,3-benzodioxine-6-carboxylic acid is O=C(O)c1ccc2c(c1)C(F)(F)OC(F)(F)O2.
What is the InChIKey of 2,2,4,4-tetrafluoro-1,3-benzodioxine-6-carboxylic acid?
The InChIKey is CPZNLLATGPLFOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H4F4O4/c10-8(11)5-3-4(7(14)15)1-2-6(5)16-9(12,13)17-8/h1-3H,(H,14,15).
What are the key properties of 2,2,4,4-tetrafluoro-1,3-benzodioxine-6-carboxylic acid?
2,2,4,4-tetrafluoro-1,3-benzodioxine-6-carboxylic acid has a molecular weight of 252.12 g/mol, XLogP of 2.39, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2,4,4-tetrafluoro-1,3-benzodioxine-6-carboxylic acid is sourced from PubChem (CID 154306048), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).