C18H16F4N2O3S — CID 3874272
1-(2-benzylsulfanylethyl)-3-(2,2,4,4-tetrafluoro-1,3-benzodioxin-6-yl)urea (PubChem CID 3874272) has the molecular formula C18H16F4N2O3S and a molecular weight of 416.40 g/mol. Its IUPAC name is 1-(2-benzylsulfanylethyl)-3-(2,2,4,4-tetrafluoro-1,3-benzodioxin-6-yl)urea.
| Compound Name | 1-(2-benzylsulfanylethyl)-3-(2,2,4,4-tetrafluoro-1,3-benzodioxin-6-yl)urea |
|---|---|
| PubChem CID | 3874272 |
| Molecular Formula | C18H16F4N2O3S |
| Molecular Weight | 416.40 g/mol |
| Exact Mass | 416.08 |
| IUPAC Name | 1-(2-benzylsulfanylethyl)-3-(2,2,4,4-tetrafluoro-1,3-benzodioxin-6-yl)urea |
| SMILES | O=C(NCCSCc1ccccc1)Nc1ccc2c(c1)C(F)(F)OC(F)(F)O2 |
| InChI | InChI=1S/C18H16F4N2O3S/c19-17(20)14-10-13(6-7-15(14)26-18(21,22)27-17)24-16(25)23-8-9-28-11-12-4-2-1-3-5-12/h1-7,10H,8-9,11H2,(H2,23,24,25) |
| InChIKey | YRVUIYVFWHGNIB-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.40 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|