C17H15F3N6O5 — CID 91956991
2-methyl-2-[8-methyl-3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazine-7-carbonyl]-6-nitro-4H-1,4-benzoxazin-3-one (PubChem CID 91956991) has the molecular formula C17H15F3N6O5 and a molecular weight of 440.34 g/mol. Its IUPAC name is 2-methyl-2-[8-methyl-3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazine-7-carbonyl]-6-nitro-4H-1,4-benzoxazin-3-one.
| Compound Name | 2-methyl-2-[8-methyl-3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazine-7-carbonyl]-6-nitro-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 91956991 |
| Molecular Formula | C17H15F3N6O5 |
| Molecular Weight | 440.34 g/mol |
| Exact Mass | 440.11 |
| IUPAC Name | 2-methyl-2-[8-methyl-3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazine-7-carbonyl]-6-nitro-4H-1,4-benzoxazin-3-one |
| SMILES | CC1c2nnc(C(F)(F)F)n2CCN1C(=O)C1(C)Oc2ccc([N+](=O)[O-])cc2NC1=O |
| InChI | InChI=1S/C17H15F3N6O5/c1-8-12-22-23-13(17(18,19)20)25(12)6-5-24(8)15(28)16(2)14(27)21-10-7-9(26(29)30)3-4-11(10)31-16/h3-4,7-8H,5-6H2,1-2H3,(H,21,27) |
| InChIKey | WWSKBUJYBLRQCN-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 132.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.34 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|