C23H23N5O5 — CID 91947103
2-methyl-2-[3-(1-methylbenzimidazol-2-yl)piperidine-1-carbonyl]-7-nitro-4H-1,4-benzoxazin-3-one (PubChem CID 91947103) has the molecular formula C23H23N5O5 and a molecular weight of 449.47 g/mol. Its IUPAC name is 2-methyl-2-[3-(1-methylbenzimidazol-2-yl)piperidine-1-carbonyl]-7-nitro-4H-1,4-benzoxazin-3-one.
| Compound Name | 2-methyl-2-[3-(1-methylbenzimidazol-2-yl)piperidine-1-carbonyl]-7-nitro-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 91947103 |
| Molecular Formula | C23H23N5O5 |
| Molecular Weight | 449.47 g/mol |
| Exact Mass | 449.17 |
| IUPAC Name | 2-methyl-2-[3-(1-methylbenzimidazol-2-yl)piperidine-1-carbonyl]-7-nitro-4H-1,4-benzoxazin-3-one |
| SMILES | Cn1c(C2CCCN(C(=O)C3(C)Oc4cc([N+](=O)[O-])ccc4NC3=O)C2)nc2ccccc21 |
| InChI | InChI=1S/C23H23N5O5/c1-23(21(29)25-17-10-9-15(28(31)32)12-19(17)33-23)22(30)27-11-5-6-14(13-27)20-24-16-7-3-4-8-18(16)26(20)2/h3-4,7-10,12,14H,5-6,11,13H2,1-2H3,(H,25,29) |
| InChIKey | KEBNVCIJZCSXPO-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 119.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.47 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|