C24H24N4O — CID 46974543
[3-(1-methylbenzimidazol-2-yl)piperidin-1-yl]-(4-methylquinolin-2-yl)methanone (PubChem CID 46974543) has the molecular formula C24H24N4O and a molecular weight of 384.48 g/mol. Its IUPAC name is [3-(1-methylbenzimidazol-2-yl)piperidin-1-yl]-(4-methylquinolin-2-yl)methanone.
| Compound Name | [3-(1-methylbenzimidazol-2-yl)piperidin-1-yl]-(4-methylquinolin-2-yl)methanone |
|---|---|
| PubChem CID | 46974543 |
| Molecular Formula | C24H24N4O |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | [3-(1-methylbenzimidazol-2-yl)piperidin-1-yl]-(4-methylquinolin-2-yl)methanone |
| SMILES | Cc1cc(C(=O)N2CCCC(c3nc4ccccc4n3C)C2)nc2ccccc12 |
| InChI | InChI=1S/C24H24N4O/c1-16-14-21(25-19-10-4-3-9-18(16)19)24(29)28-13-7-8-17(15-28)23-26-20-11-5-6-12-22(20)27(23)2/h3-6,9-12,14,17H,7-8,13,15H2,1-2H3 |
| InChIKey | RENNBZDYWKPOBX-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |