C19H21N3OS — CID 91947183
[3-(1-methylbenzimidazol-2-yl)piperidin-1-yl]-(5-methylthiophen-2-yl)methanone (PubChem CID 91947183) has the molecular formula C19H21N3OS and a molecular weight of 339.46 g/mol. Its IUPAC name is [3-(1-methylbenzimidazol-2-yl)piperidin-1-yl]-(5-methylthiophen-2-yl)methanone.
| Compound Name | [3-(1-methylbenzimidazol-2-yl)piperidin-1-yl]-(5-methylthiophen-2-yl)methanone |
|---|---|
| PubChem CID | 91947183 |
| Molecular Formula | C19H21N3OS |
| Molecular Weight | 339.46 g/mol |
| Exact Mass | 339.14 |
| IUPAC Name | [3-(1-methylbenzimidazol-2-yl)piperidin-1-yl]-(5-methylthiophen-2-yl)methanone |
| SMILES | Cc1ccc(C(=O)N2CCCC(c3nc4ccccc4n3C)C2)s1 |
| InChI | InChI=1S/C19H21N3OS/c1-13-9-10-17(24-13)19(23)22-11-5-6-14(12-22)18-20-15-7-3-4-8-16(15)21(18)2/h3-4,7-10,14H,5-6,11-12H2,1-2H3 |
| InChIKey | WBCPMOIXVUOWPY-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.46 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |