C19H22N6O — CID 46975918
[2-(methylamino)pyrimidin-5-yl]-[3-(1-methylbenzimidazol-2-yl)piperidin-1-yl]methanone (PubChem CID 46975918) has the molecular formula C19H22N6O and a molecular weight of 350.43 g/mol. Its IUPAC name is [2-(methylamino)pyrimidin-5-yl]-[3-(1-methylbenzimidazol-2-yl)piperidin-1-yl]methanone.
| Compound Name | [2-(methylamino)pyrimidin-5-yl]-[3-(1-methylbenzimidazol-2-yl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 46975918 |
| Molecular Formula | C19H22N6O |
| Molecular Weight | 350.43 g/mol |
| Exact Mass | 350.19 |
| IUPAC Name | [2-(methylamino)pyrimidin-5-yl]-[3-(1-methylbenzimidazol-2-yl)piperidin-1-yl]methanone |
| SMILES | CNc1ncc(C(=O)N2CCCC(c3nc4ccccc4n3C)C2)cn1 |
| InChI | InChI=1S/C19H22N6O/c1-20-19-21-10-14(11-22-19)18(26)25-9-5-6-13(12-25)17-23-15-7-3-4-8-16(15)24(17)2/h3-4,7-8,10-11,13H,5-6,9,12H2,1-2H3,(H,20,21,22) |
| InChIKey | NXOOIZYXUSOBPU-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.43 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |