C19H26N4O3S — CID 91946978
[3-(1-methylbenzimidazol-2-yl)piperidin-1-yl]-(1-methylsulfonylpyrrolidin-2-yl)methanone (PubChem CID 91946978) has the molecular formula C19H26N4O3S and a molecular weight of 390.51 g/mol. Its IUPAC name is [3-(1-methylbenzimidazol-2-yl)piperidin-1-yl]-(1-methylsulfonylpyrrolidin-2-yl)methanone.
| Compound Name | [3-(1-methylbenzimidazol-2-yl)piperidin-1-yl]-(1-methylsulfonylpyrrolidin-2-yl)methanone |
|---|---|
| PubChem CID | 91946978 |
| Molecular Formula | C19H26N4O3S |
| Molecular Weight | 390.51 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | [3-(1-methylbenzimidazol-2-yl)piperidin-1-yl]-(1-methylsulfonylpyrrolidin-2-yl)methanone |
| SMILES | Cn1c(C2CCCN(C(=O)C3CCCN3S(C)(=O)=O)C2)nc2ccccc21 |
| InChI | InChI=1S/C19H26N4O3S/c1-21-16-9-4-3-8-15(16)20-18(21)14-7-5-11-22(13-14)19(24)17-10-6-12-23(17)27(2,25)26/h3-4,8-9,14,17H,5-7,10-13H2,1-2H3 |
| InChIKey | VRNLUUPNDJPOKU-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 75.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.51 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |