C14H19N3O3S — CID 95729485
[(2S)-1-methylsulfonylpyrrolidin-2-yl]-(3-pyridin-2-ylazetidin-1-yl)methanone (PubChem CID 95729485) has the molecular formula C14H19N3O3S and a molecular weight of 309.39 g/mol. Its IUPAC name is [(2S)-1-methylsulfonylpyrrolidin-2-yl]-(3-pyridin-2-ylazetidin-1-yl)methanone.
| Compound Name | [(2S)-1-methylsulfonylpyrrolidin-2-yl]-(3-pyridin-2-ylazetidin-1-yl)methanone |
|---|---|
| PubChem CID | 95729485 |
| Molecular Formula | C14H19N3O3S |
| Molecular Weight | 309.39 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | [(2S)-1-methylsulfonylpyrrolidin-2-yl]-(3-pyridin-2-ylazetidin-1-yl)methanone |
| SMILES | CS(=O)(=O)N1CCC[C@H]1C(=O)N1CC(c2ccccn2)C1 |
| InChI | InChI=1S/C14H19N3O3S/c1-21(19,20)17-8-4-6-13(17)14(18)16-9-11(10-16)12-5-2-3-7-15-12/h2-3,5,7,11,13H,4,6,8-10H2,1H3/t13-/m0/s1 |
| InChIKey | CLWBCRXCNRQRON-ZDUSSCGKSA-N |
| XLogP | 0.43 |
| TPSA | 70.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.39 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |