C12H26N2O4SSi2 — CID 139202492
[(2S)-1-methylsulfonylpyrrolidin-2-yl]-(2,2,6,6-tetramethyl-1,4,2,6-oxazadisilinan-4-yl)methanone (PubChem CID 139202492) has the molecular formula C12H26N2O4SSi2 and a molecular weight of 350.59 g/mol. Its IUPAC name is [(2S)-1-methylsulfonylpyrrolidin-2-yl]-(2,2,6,6-tetramethyl-1,4,2,6-oxazadisilinan-4-yl)methanone.
| Compound Name | [(2S)-1-methylsulfonylpyrrolidin-2-yl]-(2,2,6,6-tetramethyl-1,4,2,6-oxazadisilinan-4-yl)methanone |
|---|---|
| PubChem CID | 139202492 |
| Molecular Formula | C12H26N2O4SSi2 |
| Molecular Weight | 350.59 g/mol |
| Exact Mass | 350.12 |
| IUPAC Name | [(2S)-1-methylsulfonylpyrrolidin-2-yl]-(2,2,6,6-tetramethyl-1,4,2,6-oxazadisilinan-4-yl)methanone |
| SMILES | C[Si]1(C)CN(C(=O)[C@@H]2CCCN2S(C)(=O)=O)C[Si](C)(C)O1 |
| InChI | InChI=1S/C12H26N2O4SSi2/c1-19(16,17)14-8-6-7-11(14)12(15)13-9-20(2,3)18-21(4,5)10-13/h11H,6-10H2,1-5H3/t11-/m0/s1 |
| InChIKey | AZKYVBGYHQXIHX-NSHDSACASA-N |
| XLogP | 0.76 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.59 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|