C12H21N3O5S — CID 43521379
2-[4-(1-methylsulfonylpyrrolidine-2-carbonyl)piperazin-1-yl]acetic acid (PubChem CID 43521379) has the molecular formula C12H21N3O5S and a molecular weight of 319.38 g/mol. Its IUPAC name is 2-[4-(1-methylsulfonylpyrrolidine-2-carbonyl)piperazin-1-yl]acetic acid.
| Compound Name | 2-[4-(1-methylsulfonylpyrrolidine-2-carbonyl)piperazin-1-yl]acetic acid |
|---|---|
| PubChem CID | 43521379 |
| Molecular Formula | C12H21N3O5S |
| Molecular Weight | 319.38 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | 2-[4-(1-methylsulfonylpyrrolidine-2-carbonyl)piperazin-1-yl]acetic acid |
| SMILES | CS(=O)(=O)N1CCCC1C(=O)N1CCN(CC(=O)O)CC1 |
| InChI | InChI=1S/C12H21N3O5S/c1-21(19,20)15-4-2-3-10(15)12(18)14-7-5-13(6-8-14)9-11(16)17/h10H,2-9H2,1H3,(H,16,17) |
| InChIKey | HMASREPTFKQLLN-UHFFFAOYSA-N |
| XLogP | -1.36 |
| TPSA | 98.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.38 |
| LogP ≤ 5 | -1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |