C14H19N3O2S — CID 94179592
1-methyl-2-[(2S)-1-methylsulfonylpiperidin-2-yl]benzimidazole (PubChem CID 94179592) has the molecular formula C14H19N3O2S and a molecular weight of 293.39 g/mol. Its IUPAC name is 1-methyl-2-[(2S)-1-methylsulfonylpiperidin-2-yl]benzimidazole.
| Compound Name | 1-methyl-2-[(2S)-1-methylsulfonylpiperidin-2-yl]benzimidazole |
|---|---|
| PubChem CID | 94179592 |
| Molecular Formula | C14H19N3O2S |
| Molecular Weight | 293.39 g/mol |
| Exact Mass | 293.12 |
| IUPAC Name | 1-methyl-2-[(2S)-1-methylsulfonylpiperidin-2-yl]benzimidazole |
| SMILES | Cn1c([C@@H]2CCCCN2S(C)(=O)=O)nc2ccccc21 |
| InChI | InChI=1S/C14H19N3O2S/c1-16-12-8-4-3-7-11(12)15-14(16)13-9-5-6-10-17(13)20(2,18)19/h3-4,7-8,13H,5-6,9-10H2,1-2H3/t13-/m0/s1 |
| InChIKey | AFKVSZOHWHMYFN-ZDUSSCGKSA-N |
| XLogP | 2.06 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.39 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |