C25H28N4O2S — CID 91947280
2-methyl-2-[3-(1-propylbenzimidazol-2-yl)piperidine-1-carbonyl]-4H-1,4-benzothiazin-3-one (PubChem CID 91947280) has the molecular formula C25H28N4O2S and a molecular weight of 448.59 g/mol. Its IUPAC name is 2-methyl-2-[3-(1-propylbenzimidazol-2-yl)piperidine-1-carbonyl]-4H-1,4-benzothiazin-3-one.
| Compound Name | 2-methyl-2-[3-(1-propylbenzimidazol-2-yl)piperidine-1-carbonyl]-4H-1,4-benzothiazin-3-one |
|---|---|
| PubChem CID | 91947280 |
| Molecular Formula | C25H28N4O2S |
| Molecular Weight | 448.59 g/mol |
| Exact Mass | 448.19 |
| IUPAC Name | 2-methyl-2-[3-(1-propylbenzimidazol-2-yl)piperidine-1-carbonyl]-4H-1,4-benzothiazin-3-one |
| SMILES | CCCn1c(C2CCCN(C(=O)C3(C)Sc4ccccc4NC3=O)C2)nc2ccccc21 |
| InChI | InChI=1S/C25H28N4O2S/c1-3-14-29-20-12-6-4-10-18(20)26-22(29)17-9-8-15-28(16-17)24(31)25(2)23(30)27-19-11-5-7-13-21(19)32-25/h4-7,10-13,17H,3,8-9,14-16H2,1-2H3,(H,27,30) |
| InChIKey | WQIWBPPNXOTEDL-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.59 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|