C19H24N4O5 — CID 91957174
2-methyl-6-nitro-3-oxo-N-[[1-(pyrrolidin-1-ylmethyl)cyclopropyl]methyl]-4H-1,4-benzoxazine-2-carboxamide (PubChem CID 91957174) has the molecular formula C19H24N4O5 and a molecular weight of 388.42 g/mol. Its IUPAC name is 2-methyl-6-nitro-3-oxo-N-[[1-(pyrrolidin-1-ylmethyl)cyclopropyl]methyl]-4H-1,4-benzoxazine-2-carboxamide.
| Compound Name | 2-methyl-6-nitro-3-oxo-N-[[1-(pyrrolidin-1-ylmethyl)cyclopropyl]methyl]-4H-1,4-benzoxazine-2-carboxamide |
|---|---|
| PubChem CID | 91957174 |
| Molecular Formula | C19H24N4O5 |
| Molecular Weight | 388.42 g/mol |
| Exact Mass | 388.17 |
| IUPAC Name | 2-methyl-6-nitro-3-oxo-N-[[1-(pyrrolidin-1-ylmethyl)cyclopropyl]methyl]-4H-1,4-benzoxazine-2-carboxamide |
| SMILES | CC1(C(=O)NCC2(CN3CCCC3)CC2)Oc2ccc([N+](=O)[O-])cc2NC1=O |
| InChI | InChI=1S/C19H24N4O5/c1-18(16(24)20-11-19(6-7-19)12-22-8-2-3-9-22)17(25)21-14-10-13(23(26)27)4-5-15(14)28-18/h4-5,10H,2-3,6-9,11-12H2,1H3,(H,20,24)(H,21,25) |
| InChIKey | GEODZUWDLJFRSX-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 113.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.42 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|