C19H22N4O6 — CID 91953736
N-cyclopropyl-2-methyl-7-nitro-3-oxo-N-(piperidine-3-carbonyl)-4H-1,4-benzoxazine-2-carboxamide (PubChem CID 91953736) has the molecular formula C19H22N4O6 and a molecular weight of 402.41 g/mol. Its IUPAC name is N-cyclopropyl-2-methyl-7-nitro-3-oxo-N-(piperidine-3-carbonyl)-4H-1,4-benzoxazine-2-carboxamide.
| Compound Name | N-cyclopropyl-2-methyl-7-nitro-3-oxo-N-(piperidine-3-carbonyl)-4H-1,4-benzoxazine-2-carboxamide |
|---|---|
| PubChem CID | 91953736 |
| Molecular Formula | C19H22N4O6 |
| Molecular Weight | 402.41 g/mol |
| Exact Mass | 402.15 |
| IUPAC Name | N-cyclopropyl-2-methyl-7-nitro-3-oxo-N-(piperidine-3-carbonyl)-4H-1,4-benzoxazine-2-carboxamide |
| SMILES | CC1(C(=O)N(C(=O)C2CCCNC2)C2CC2)Oc2cc([N+](=O)[O-])ccc2NC1=O |
| InChI | InChI=1S/C19H22N4O6/c1-19(17(25)21-14-7-6-13(23(27)28)9-15(14)29-19)18(26)22(12-4-5-12)16(24)11-3-2-8-20-10-11/h6-7,9,11-12,20H,2-5,8,10H2,1H3,(H,21,25) |
| InChIKey | BAKZAQIJNXLGOE-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 130.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.41 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|