C18H22N2O2S2 — CID 91950476
N-cyclopropyl-N-(2-ethylthieno[2,3-b]thiophene-5-carbonyl)piperidine-3-carboxamide (PubChem CID 91950476) has the molecular formula C18H22N2O2S2 and a molecular weight of 362.52 g/mol. Its IUPAC name is N-cyclopropyl-N-(2-ethylthieno[2,3-b]thiophene-5-carbonyl)piperidine-3-carboxamide.
| Compound Name | N-cyclopropyl-N-(2-ethylthieno[2,3-b]thiophene-5-carbonyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 91950476 |
| Molecular Formula | C18H22N2O2S2 |
| Molecular Weight | 362.52 g/mol |
| Exact Mass | 362.11 |
| IUPAC Name | N-cyclopropyl-N-(2-ethylthieno[2,3-b]thiophene-5-carbonyl)piperidine-3-carboxamide |
| SMILES | CCc1cc2cc(C(=O)N(C(=O)C3CCCNC3)C3CC3)sc2s1 |
| InChI | InChI=1S/C18H22N2O2S2/c1-2-14-8-12-9-15(24-18(12)23-14)17(22)20(13-5-6-13)16(21)11-4-3-7-19-10-11/h8-9,11,13,19H,2-7,10H2,1H3 |
| InChIKey | DUYKUBHGPGMOAL-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.52 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|