C19H20ClN3O3 — CID 91953663
5-(4-chlorophenyl)-N-cyclopropyl-N-(piperidine-3-carbonyl)-1,2-oxazole-3-carboxamide (PubChem CID 91953663) has the molecular formula C19H20ClN3O3 and a molecular weight of 373.84 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-N-cyclopropyl-N-(piperidine-3-carbonyl)-1,2-oxazole-3-carboxamide.
| Compound Name | 5-(4-chlorophenyl)-N-cyclopropyl-N-(piperidine-3-carbonyl)-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 91953663 |
| Molecular Formula | C19H20ClN3O3 |
| Molecular Weight | 373.84 g/mol |
| Exact Mass | 373.12 |
| IUPAC Name | 5-(4-chlorophenyl)-N-cyclopropyl-N-(piperidine-3-carbonyl)-1,2-oxazole-3-carboxamide |
| SMILES | O=C(c1cc(-c2ccc(Cl)cc2)on1)N(C(=O)C1CCCNC1)C1CC1 |
| InChI | InChI=1S/C19H20ClN3O3/c20-14-5-3-12(4-6-14)17-10-16(22-26-17)19(25)23(15-7-8-15)18(24)13-2-1-9-21-11-13/h3-6,10,13,15,21H,1-2,7-9,11H2 |
| InChIKey | NPKUAYYDJJNORS-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 75.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.84 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|