C21H25N3O5S — CID 91949812
N-cyclopropyl-5-(4-ethylsulfonylphenyl)-N-(piperidine-3-carbonyl)-1,2-oxazole-3-carboxamide (PubChem CID 91949812) has the molecular formula C21H25N3O5S and a molecular weight of 431.51 g/mol. Its IUPAC name is N-cyclopropyl-5-(4-ethylsulfonylphenyl)-N-(piperidine-3-carbonyl)-1,2-oxazole-3-carboxamide.
| Compound Name | N-cyclopropyl-5-(4-ethylsulfonylphenyl)-N-(piperidine-3-carbonyl)-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 91949812 |
| Molecular Formula | C21H25N3O5S |
| Molecular Weight | 431.51 g/mol |
| Exact Mass | 431.15 |
| IUPAC Name | N-cyclopropyl-5-(4-ethylsulfonylphenyl)-N-(piperidine-3-carbonyl)-1,2-oxazole-3-carboxamide |
| SMILES | CCS(=O)(=O)c1ccc(-c2cc(C(=O)N(C(=O)C3CCCNC3)C3CC3)no2)cc1 |
| InChI | InChI=1S/C21H25N3O5S/c1-2-30(27,28)17-9-5-14(6-10-17)19-12-18(23-29-19)21(26)24(16-7-8-16)20(25)15-4-3-11-22-13-15/h5-6,9-10,12,15-16,22H,2-4,7-8,11,13H2,1H3 |
| InChIKey | KYWQENKGJVKCQS-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 109.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.51 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|